Zu "301847-37-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Org41841
Artikelnummer: TGM-T16403-1mg
Description: Org41841 is an agonist of luteinising hormone/chorionic gonadotropin receptor and thyroid stimulating hormone receptor (EC50s: 0.2 and 7.7 µM, respectively) and can be used to study hyperthyroidism. Target: TSH Receptor. Smiles: COc1cccc(c1)-c1nc(SC)nc2sc(C(=O)NC(C)(C)C)c(N)c12. References: Holger...
| Schlagworte: | Org-41841 |
| Anwendung: | Dual LH / TSH receptor agonist |
| CAS | 301847-37-0 |
| MW: | 402.53 D |
198,00 €
ORG 41841
Artikelnummer: Cay37724-1
ORG 41841 is a dual luteinizing hormone (LH) and thyroid-stimulating hormone (TSH) receptor agonist. It induces cAMP production in HEK293 cells expressing human LH or TSH receptors (EC50s = 0.3 and 6.5 µM, respectively).Formal Name:...
| Schlagworte: | 5-amino-N-(1,1-dimethylethyl)-4-(3-methoxyphenyl)-2-(methylthio)-thieno[2,3-d]pyrimidine-6-carboxamide |
| Anwendung: | Dual LH / TSH receptor agonist |
| CAS | 301847-37-0 |
| MW: | 402.5 D |
ab 67,00 €
