Zu "301326-22-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CH 223191
Artikelnummer: Cay16154-5
The aryl hydrocarbon receptor (AhR) is a ligand-activated transcription factor that up-regulates many xenobiotic metabolizing enzymes, particularly in response to planar aromatic hydrocarbons. CH 223191 is a potent and specific antagonist of AhR that blocks activation by 2,3,7,8-tetrachlorodibenzo-p-dioxin (TCDD,...
| Schlagworte: | 1-methyl-N-[2-methyl-4-[2-(2-methylphenyl)diazenyl]phenyl]-1H-pyrazole-5-carboxamide |
| Anwendung: | Aryl hydrocarbon receptor (AhR) antagonist |
| CAS | 301326-22-7 |
| MW: | 333.4 D |
ab 103,00 €
CH-223191
Artikelnummer: TGM-T2448-100mg
Description: CH-223191 is a potent and specific antagonist for the aryl hydrocarbon receptor (AhR). Target: Aryl Hydrocarbon Receptor, AhR. Smiles: Cc1ccccc1\N=N\c1ccc(NC(=O)c2ccnn2C)c(C)c1. References: Kim SH, et al. Mol Pharmacol. 2006, 69(6), 1871-1878.
| Schlagworte: | CH 223191 |
| CAS | 301326-22-7 |
| MW: | 333.39 D |
ab 53,00 €
