Zu "300-39-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
3,5-Diiodo-L-tyrosine dihydrate
Artikelnummer: TGM-TN6749-1g
Description: 3,5-Diiodo-L-tyrosine dihydrate is a natural product. Target: Others. Smiles: O.O.N[C@@H](Cc1cc(I)c(O)c(I)c1)C(O)=O
| CAS | 300-39-0 |
| MW: | 432.98 D |
ab 40,00 €
3,5-Diiodo-L-tyrosine
Artikelnummer: Cay36266-50
3,5-Diiodo-L-tyrosine is an intermediate in the biosynthesis of the thyroid hormone thyroxine (T4). It inhibits tyrosine hydroxylase (IC50 = 20 µM).Formal Name: (S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid. CAS Number: 300-39-0. Synonyms: 3,5-Diiodotyrosine, DIT, NSC 4143. Molecular Formula: C9H9I2NO3....
| Schlagworte: | 3,5-Diiodotyrosine, DIT, NSC 4143, (S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid |
| Anwendung: | Thyroid hormone thyroxine biosynthesis intermediate, tyrosine hydroxylase inhibitor |
| CAS | 300-39-0 |
| MW: | 433 D |
ab 40,00 €
