Zu "299-75-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
Treosulfan
Artikelnummer: TGM-T17159-100mg
Description: Treosulfan (Treosulphan) is a bifunctional alkylating agent. It also has activity in ovarian cancer and other solid tumor types. Target: DNA Alkylation, DNA Alkylator/Crosslinker. Smiles: CS(=O)(=O)OC[C@H](O)[C@@H](O)COS(C)(=O)=O. References: Nitsch E, et al. Synergistic cytotoxic activity of...
| Schlagworte: | NSC 39069, Treosulphan |
| Anwendung: | Antineoplastic, Alkylating agent |
| CAS | 299-75-2 |
| MW: | 278.3 D |
ab 32,00 €
Treosulfan
Artikelnummer: CSB-DT4894.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| CAS | 299-75-2 |
| MW: | 278.29 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
