Zu "297180-15-5" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Lipofermata
Artikelnummer: TGM-T11854-100mg
Description: Lipofermata, a fatty acid transport protein (FATP) inhibitor, prevents lipid transport to melanoma cells and reduces their growth and invasion. Target: Antibacterial, Others. Smiles: Brc1ccc2NC(=O)C3(NN=C(S3)c3ccccc3)c2c1. References: Zhang M,et al. Adipocyte-Derived Lipids Mediate Melanoma Progression...
| CAS | 297180-15-5 |
| MW: | 360.23 D |
ab 55,00 €
Lipofermata
Artikelnummer: Cay25869-10
Lipofermata is an inhibitor of fatty acid transport (IC50 = 4.84 µM in Caco-2 cells). It inhibits uptake of long- and very long-chain, but not medium-chain, fatty acids in mmC2C12, rnINS-1E, Caco-2, and HepG2 cells (IC50s = 3-6 µM). Lipofermata inhibits induction of BiP and CHOP, apoptosis, and lipid droplet...
| Schlagworte: | 5-bromo-5'-phenyl-spiro[3H-indole-3,2'(3'H)-[1,3,4]thiadiazol]-2(1H)-one |
| Anwendung: | Fatty acid transport inhibitor |
| CAS | 297180-15-5 |
| MW: | 360.2 D |
ab 55,00 €
Lipofermata
Artikelnummer: AG-CR1-3542-M010
Lipofermata is an inhibitor of fatty acid transport, blocking fatty acid transport protein 2 (FATP2), and was identified afterwards as a FATP1 inhibitor as well. Inhibition was specific for long and very long chain fatty acids but not medium (C6-C10) fatty acids in myocytes (mmC2C12), pancreatic beta cells...
| Schlagworte: | 5´-Bromo-5-phenyl-spiro[3H-1,3,4-thiadiazole-2,3´-indoline]-2´-one, CB16.2 |
| Anwendung: | Fatty acid transport inhibitor |
| CAS | 297180-15-5 |
| MW: | 360,2 D |
ab 77,00 €
