Zu "2941228-90-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
RM 133-3
Artikelnummer: Cay38917-10
RM 133-3 is an ionizable cationic lipid that has been used in the formation of lipid nanoparticles (LNPs) for the delivery of mRNA in vivo. LNPs containing RM 133-3 and encapsulating mRNA encoding human erythropoietin (EPO) increase serum human EPO protein levels in mice.Formal Name:...
| Schlagworte: | (9Z,9'Z)-((3,3'-((3-(diethylamino)propyl)azanediyl)bis(propanoyl))bis(oxy))bis(octadec-9-ene-18,7-diyl)... |
| Anwendung: | Ionizable cationic lipid, LNP formation |
| CAS | 2941228-90-4 |
| MW: | 1376.2 D |
ab 391,00 €
MR-2-93-3
Artikelnummer: TGM-T84667-10mg
Description: MR-2-93-3, a long-chain fatty acid, functions as a carrier for polynucleotides [1]. Target: Others. Smiles: N(CCCN(CC)CC)(CCC(OCCCCCCCC/C=C\CC(OC(CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)=O)CCCCCC)=O)CCC(OCCCCCCCC/C=C\CC(OC(CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)=O)CCCCCC)=O
| Schlagworte: | RML-1 |
| CAS | 2941228-90-4 |
| MW: | 1376.15 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
