Zu "29388-59-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Secoisolariciresinol
Artikelnummer: TGM-TN2197-100mg
Description: Secoisolariciresinol is an enterolignan precursor, it has antioxidant, and estrogen-like activities, it can significantly suppress triglyceride (TG) accumulation in 3T3-L1 adipocytes. Target: TNF. Smiles: COc1cc(C[C@@H](CO)[C@H](CO)Cc2ccc(O)c(OC)c2)ccc1O. References: The Effect of Secoisolariciresinol...
| CAS | 29388-59-8 |
| MW: | 362.42 D |
ab 128,00 €
(+)-Secoisolariciresinol
Artikelnummer: Cay33155-1
(+)-Secoisolariciresinol ((+)-SECO) is a lignan that has been found in flaxseed and has diverse biological activities. It inhibits alpha-glucosidase and alpha-amylase in a cell-free assay when used at a concentration of 20 µM. (+)-SECO (0.3 mM) reduces adiponectin production by, and triglyceride accumulation in,...
| Schlagworte: | 2R,3R-bis[(4-hydroxy-3-methoxyphenyl)methyl]-1,4-butanediol |
| Anwendung: | Bioactive lignan |
| CAS | 29388-59-8 |
| MW: | 362.4 D |
ab 67,00 €
