Zu "293753-05-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SR3335
Artikelnummer: TGM-T5160-100mg
Description: SR3335 (ML 176) is a selective inverse agonist of RORalpha that competitively inhibits the binding of 25-hydroxycholesterol to the ligand binding domain (Ki: 220 nM). Target: ROR. Smiles: OC(c1ccc(NS(=O)(=O)c2cccs2)cc1)(C(F)(F)F)C(F)(F)F. References: Kumar N, et al. Identification of SR3335 (ML-176): a...
| Schlagworte: | ML 176 |
| Anwendung: | RORalpha agonist |
| CAS | 293753-05-6 |
| MW: | 405.34 D |
ab 31,00 €
SR 3335
Artikelnummer: Cay12072-25
The retinoic acid receptor-related receptors (RORs) are orphan nuclear receptors with diverse putative roles. SR 3335 is a selective inverse agonist of RORalpha, competitively inhibiting the binding of 25-hydroxycholesterol to the ligand binding domain (Ki = 220 nM) and inhibiting constitutive transactivation...
| Schlagworte: | ML 176, N-[4-[2,2,2-trifluoro-1-hydroxy-1-(trifluoromethyl)ethyl]phenyl]-2-thiophenesulfonamide |
| Anwendung: | RORalpha agonist |
| CAS | 293753-05-6 |
| MW: | 405.3 D |
ab 44,00 €
