Zu "2923008-66-4" wurden 1 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GSK_WRN4
Artikelnummer: Cay45316-1
A covalent inhibitor of WRN (IC50 = 25 nM), inhibits tumor growth and increases the intratumoral levels of the DNA damage markers p21, phosphorylated gammaH2AX, and phosphorylated KAP-1 in an SW48 mouse xenograft model at 300 mg/kg. SMILES: O=S(C=C[C@H]1NC(C2=CC=C(NC2=O)C3CCCCC3)=O)(C1)=O. InChi Code:...
| Schlagworte: | 6-cyclohexyl-N-[(3R)-2,3-dihydro-1,1-dioxido-3-thienyl]-1,2-dihydro-2-oxo-3-pyridinecarboxamide |
| Anwendung: | Covalent WRN (RECQL2/RECQ3) inhibitor |
| CAS | 2923008-66-4 |
| MW: | 336.41 D |
ab 730,00 €
