Zu "2922286-32-4" wurden 1 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PAG 4'-piperazine (hydrochloride)
Artikelnummer: Cay41881-100
A PROTAC building block, has been used in the synthesis of PROTACs that drive RET or BRD4 degradation. Formulation: A solid. InChI: InChI=1S/C15H20N4O2.2ClH/c20-14-6-5-13(15(21)18-14)17-11-1-3-12(4-2-11)19-9-7-16-8-10-19,,/h1-4,13,16-17H,5-10H2,(H,18,20,21),2*1H. InChIKey: RLSJIUIOQYODBF-UHFFFAOYSA-N. SMILES:...
| Schlagworte: | 3-[[4-(1-piperazinyl)phenyl]amino]-2,6-piperidinedione, dihydrochloride |
| Anwendung: | PROTAC building block |
| CAS | 2922286-32-4 |
| MW: | 361.3 D |
ab 73,00 €
