Zu "28052-84-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
5-methoxy-DL-Tryptophan
Artikelnummer: Cay31222-100
5-methoxy-DL-Tryptophan (DL-5-MTP) is an active metabolite of tryptophan with anti-inflammatory and anticancer activities. It reduces LPS-induced expression of COX-2, TNF-alpha, IL-1beta, and IL-6 in RAW 264.7 macrophages when used at a concentration of 50 mM. DL-5-MTP (23.4 mg/kg) increases survival in a mouse...
| Schlagworte: | 5-Methoxytryptophan, DL-5-Methoxytryptophan, DL-5-MTP, 5-methoxy-tryptophan |
| Anwendung: | Active tryptophan metabolite, antiinflammatory, antineoplastic |
| CAS | 28052-84-8 |
| MW: | 234.3 D |
ab 108,00 €
5-Methoxy-DL-tryptophan
Artikelnummer: TGM-T5235-100mg
Description: 5-Methoxy-DL-tryptophan is a molecule produced by endothelial cells to modulate inflammatory responses and protect against systemic inflammation. Target: Others, Endogenous Metabolite. Smiles: COC1=CC=C2NC=C(CC(N)C(O)=O)C2=C1. References: Wang YF, et al. Endothelium-Derived 5-Methoxytryptophan Is a...
| CAS | 28052-84-8 |
| MW: | 234.25 D |
ab 30,00 €
H-DL-Trp(5-OMe)-OH
Artikelnummer: CSB-DT1805.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Anwendung: | Peptide synthesis |
| CAS | 28052-84-8 |
| MW: | 234.255 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
