Zu "2799-07-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
S-trityl-L-Cysteine
Artikelnummer: TGM-T36816-100mg
Description: S-trityl-L-Cysteine is a potent inhibitor of human mitotic kinesin Eg5. Target: Kinesin. Smiles: C(SC[C@@H](C(O)=O)N)(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3. References: Wu W, et al. S-trityl-L-cysteine, a novel Eg5 inhibitor, is a potent chemotherapeutic strategy in neuroblastoma. Oncol Lett. 2018...
| Schlagworte: | STLC |
| Anwendung: | Kif11 inhibitor |
| CAS | 2799-07-7 |
| MW: | 363.47 D |
ab 31,00 €
S-trityl-L-Cysteine
Artikelnummer: Cay23236-1
S-trityl-L-Cysteine is a non-natural amino acid and an inhibitor of Eg5, also known as KSP and Kif11, a mitotic kinesin necessary for mitotic spindle formation. S-trityl-L-Cysteine inhibits the ATPase activity of Eg5 in basal and microtubule-stimulated states (IC50s = 1,000 and 140 nM, respectively). It is selective...
| Schlagworte: | NSC 83265, S-(triphenylmethyl)-L-cysteine |
| Anwendung: | Kif11 inhibitor |
| CAS | 2799-07-7 |
| MW: | 363.5 D |
ab 35,00 €
S-Trityl-L-cysteine
Artikelnummer: LKT-T7232.5
S-Trityl-L-cysteine (STLC) is an organosulfur compound naturally produced in garlic plants. STLC exhibits anticancer and potential chemotherapeutic activities across several models. STLC acts as a mitotic inhibitor, inhibiting mitotic kinesin Eg5 and preventing separation of duplicated chromosomes and formation of...
| Schlagworte: | NSC83265 |
| Anwendung: | Kinesin Eg5 inhibitor |
| CAS | 2799-07-7 |
| MW: | 363.47 D |
ab 139,00 €
