Zu "27876-94-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Transcrocetin
Artikelnummer: Cay24217-5
Transcrocetin is a natural apocarotenoid isolated from C. sativus and G. jasminoides that has antioxidant, antiproliferative, anti-inflammatory, cardioprotective, and antinociceptive properties. It scavenges 2,2-diphenyl-1-picrylhydrazyl (DPPH) radicals (IC50 = 17.8 µg/ml) and inhibits growth of MKN28 stomach, MCF-7...
| Schlagworte: | NSC 407300, 2,6,11,15-tetramethyl-2E,4E,6E,8E,10E,12E,14E-hexadecaheptaenedioic acid |
| Anwendung: | Antioxidant, antiproliferative, antiinflammatory, cardioprotective, antinociceptive apocarotenoid |
| CAS | 27876-94-4 |
| MW: | 328.4 D |
ab 122,00 €
Transcrocetin
Artikelnummer: TGM-T4S0171-100mg
Description: Transcrocetin (8,8'-Diapocarotenedioic Acid) is a singlet oxygen quencher. Target: Others, Endogenous Metabolite, iGluR. Smiles: CC(C=CC=C(C)C(O)=O)=CC=CC=C(C)C=CC=C(C)C(O)=O. References: Lautenschläger M, et al. Intestinal formation of trans-Crocetin from saffron extract (Crocus sativus L.) and in...
| Schlagworte: | trans-Crocetin, 8,8'-Diapocarotenedioic Acid, Crocetin |
| CAS | 27876-94-4 |
| MW: | 328.4 D |
ab 60,00 €
