Zu "27574-24-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Tropatepine
Artikelnummer: Cay43415-1
An anticholinergic agent, protects against oxotremorine-induced sinistrotorsion syndrome in guinea pigs (ED50 = 0.2-0.5 mg/kg). Formulation: A solid. InChI: InChI=1S/C22H23NS/c1-23-17-10-11-18(23)13-16(12-17)22-19-7-3-2-6-15(19)14-24-21-9-5-4-8-20(21)22/h2-9,17-18H,10-14H2,1H3. InChIKey: JOQKFRLFXDPXHX-UHFFFAOYSA-N....
| Schlagworte: | 3-dibenzo[b,e]thiepin-11(6H)-ylidene-8-methyl-8-azabicyclo[3.2.1]octane |
| Anwendung: | Muscarinic acetylcholine receptor antagonist |
| CAS | 27574-24-9 |
| MW: | 333.49 D |
ab 112,00 €
Tropatepine
Artikelnummer: TGM-T61006-100mg
Description: Tropatepine is an orally active antagonist of anticholinergic muscarinic. Tropatepine is an antiparkinsonian agent that can be used to combat against extrapyramidal syndrome caused by neuroleptic drugs [1][2]. Target: Others. Smiles: CN1C2CC(=C3C=4C(CSC=5C3=CC=CC5)=CC=CC4)CC1CC2
| Anwendung: | Antiparkinsonian, Muscarinic acetylcholine receptor antagonist |
| CAS | 27574-24-9 |
| MW: | 333.49 D |
ab 2.029,00 €
