Zu "27570-38-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Withanone
Artikelnummer: TGM-TN5259-1mg
Description: Withanone is a natural product for research related to life sciences. The catalog number is TN5259 and the CAS number is 27570-38-3. Target: Others. Smiles: [H][C@@]12CC[C@](O)([C@H](C)[C@@]3([H])CC(C)=C(C)C(=O)O3)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])[C@@H]2O[C@@H]2[C@@]2(O)CC=CC(=O)[C@]12C
| CAS | 27570-38-3 |
| MW: | 470.6 D |
ab 380,00 €
Withanone
Artikelnummer: Cay11804-1
Withanone is a phytochemical that has been found in W. somnifera and has diverse biological activities. It inhibits the protein-protein interaction between human angiotensin-converting enzyme 2 (ACE2) and the SARS-CoV-2 spike protein receptor-binding domain (IC50 = 0.33 ng/ml). Withanone (10 µg/ml) protects against...
| Schlagworte: | NSC 179884, 6alpha,7alpha-epoxy-5alpha,17,22R-trihydroxy-1-oxo-ergosta-2,24-dien-26-oic acid, delta-lactone |
| Anwendung: | Bioactive phytochemical |
| CAS | 27570-38-3 |
| MW: | 470.6 D |
ab 116,00 €
