Zu "2682114-39-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
RBPJ Inhibitor-1
Artikelnummer: Cay43358-10
RBPJ inhibitor-1 is an inhibitor of recombination signal binding protein for immunoglobulin kappa J region (RBPJ, IC50 = 0.18 µM in a reporter assay). It also inhibits the protein-protein interaction between RBPJ and the neurogenic locus notch homolog protein 2 (Notch2) intracellular domain (NICD) and the...
| Schlagworte: | RIN1, 2-(2-fluorophenoxy)-4-(1-methyl-1H-pyrazol-5-yl)-benzamide |
| Anwendung: | RBPJ inhibitor |
| CAS | 2682114-39-0 |
| MW: | 311.32 D |
ab 146,00 €
RBPJ Inhibitor-1
Artikelnummer: TGM-T35566-100mg
Description: RBPJ Inhibitor-1 (RIN1), a compound that impedes the functional interaction between RBPJ and SHARP, effectively inhibits NOTCH-dependent tumor cell proliferation[1]. Target: Gamma-secretase. Smiles: O(C1=C(C(N)=O)C=CC(=C1)C=2N(C)N=CC2)C3=C(F)C=CC=C3. References: Hurtado C, et al. Disruption of NOTCH...
| Schlagworte: | RIN1 |
| Anwendung: | RBPJ inhibitor |
| CAS | 2682114-39-0 |
| MW: | 311.31 D |
ab 33,00 €
