Zu "265646-85-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Endovion
Artikelnummer: TGM-T15233-100mg
Description: Endovion (NS3728) is a pharmacological anion channel and an Anoctamin-1 (ANO 1) channel inhibitor. Endovion is also the specific VRAC/VSOAC blocker. Target: Chloride channel. Smiles: FC(F)(F)c1cc(NC(=O)Nc2ccc(Br)cc2-c2nn[nH]n2)cc(c1)C(F)(F)F. References: Sørensen BH, et al. Downregulation of LRRC8A...
| Schlagworte: | NS3728 |
| Anwendung: | Chloride channel inhibitor |
| CAS | 265646-85-3 |
| MW: | 495.18 D |
ab 31,00 €
NS 3728
Artikelnummer: Cay39988-10
NS 3728 is a chloride channel inhibitor. It inhibits the volume-regulated anion channel (VRAC) in HEK293 cells and chloride conductance in washed isolated human erythrocytes (IC50s = 0.4 and 0.6 µM, respectively). NS 3728 also inhibits calcium-activated chloride currents in Ehrlich-Lettre ascites carcinoma cells...
| Schlagworte: | Endovion, SCO 101, N-[3,5-bis(trifluoromethyl)phenyl]-N'-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]-urea |
| Anwendung: | Chloride channel inhibitor |
| CAS | 265646-85-3 |
| MW: | 495.2 D |
ab 136,00 €
