Zu "2636846-41-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Rezatapopt
Artikelnummer: Cay44358-1
Rezatapopt is a reactivator of p53 containing a tyrosine-to-cysteine substitution at position 220 (p53Y220C). It increases p53Y220C DNA binding by 1.5-fold in a time-resolved FRET (TR-FRET) assay when used at a concentration of 9 nM. Rezatapopt decreases the proliferation of NUGC-3 gastric carcinoma cells (IC50 =...
| Schlagworte: | PC14586, 4-[[3-[4-[[(3S,4R)-3-fluoro-1-methyl-4-piperidinyl]... |
| Anwendung: | P53Y220C reactivator, antineoplastic |
| CAS | 2636846-41-6 |
| MW: | 545,58 D |
ab 49,00 €
Rezatapopt
Artikelnummer: TGM-T81289-5mg
Description: Rezatapopt is an antineoplastic agent designed to inhibit solid tumors harboring p53 mutations [1]. Target: Others. Smiles: N(C1=C2C(N(CC(F)(F)F)C(C#CCNC3=C(OC)C=C(C(NC)=O)C=C3)=C2)=CC=C1)[C@H]4[C@@H](F)CN(C)CC4
| CAS | 2636846-41-6 |
| MW: | 545.57 D |
153,00 €
