Zu "2636-26-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cyanophos
Artikelnummer: CDX-C0604-M025
Cyanophos is an organophosphate insecticide, which is effectively used against various root-parasitic nematodes such as Diaspididae, Lepidoptera, Coccidae, Aphididae and other insects on various fruits and vegetables. It is a acetylcholinesterase (AChE) inhibitor and antagonist of NMDA receptors. It shows a moderate...
| Schlagworte: | O-(4-Cyanophenyl) O,O-dimethyl phosphorothioate, 4-Dimethoxyphosphinothioyloxybenzonitrile, BAY 34727, CYAP |
| Anwendung: | Organophosphate insecticide, AChE inhibitor, NMDA receptor antagonist |
| CAS | 2636-26-2 |
| MW: | 243.22 D |
109,00 €
Cyanophos
Artikelnummer: TGM-T69556-100mg
Description: Cyanophos is a cholinesterase inhibitor used as an insecticide and avicide, for example, against rice stem borers and house flies. It is part of the chemical class of organophosphorus compounds, and is a yellow to reddish-yellow transparent liquid. Target: Others. Smiles: P(OC1=CC=C(C#N)C=C1)(OC)(OC)=S
| Anwendung: | Organophosphate insecticide, AChE inhibitor, NMDA receptor antagonist |
| CAS | 2636-26-2 |
| MW: | 243.22 D |
ab 1.440,00 €
