Zu "257292-29-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
KF38789
Artikelnummer: Cay43182-1
An inhibitor of P-selectin-mediated cell adhesion, inhibits U937 cell binding to immobilized P-selectin immunoglobin (IC50 = 1.97 µM), selective for P-selectin-mediated cell adhesion over E- and or L-selectin-mediated adhesion of U937 and HL-60 cells, respectively, at 100 µM, decreases P-selectin-induced superoxide...
| Schlagworte: | 3-[7-(2,4-dimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]-4-hydroxy-6-methyl-2H-pyran-2-one |
| Anwendung: | P-selectin-mediated cell adhesion inhibitor |
| CAS | 257292-29-8 |
| MW: | 375.44 D |
ab 53,00 €
KF38789
Artikelnummer: TGM-T22889-10mg
Description: KF38789 is a selective inhibitor of P-selectin-mediated cell adhesion and P-selectin immunoglobulin G chimeric protein (IgG). Target: Others. Smiles: COc1ccc(C2CC(=NCCS2)C2C(O)OC(C)=CC2=O)c(OC)c1. References: S Ohta, et al. Inhibition of P-selectin specific cell adhesion by a low molecular weight,...
| Schlagworte: | KF 38789 |
| CAS | 257292-29-8 |
| MW: | 375.44 D |
ab 50,00 €
