Zu "25717-80-0" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Molsidomine
Artikelnummer: TGM-T0109-1mL
Description: Molsidomine (Corvaton) is an orally active, long-acting vasodilating drug. It metabolizes in the liver to the active metabolite linsidomine, that releases nitric oxide (NO) upon decay as the actual vasodilating compound. Target: NOD. Smiles: [N-](C(OCC)=O)C1=C[N+](=NO1)N2CCOCC2. References: Volker B....
| Schlagworte: | SIN-10, Morsydomine, Corvaton |
| CAS | 25717-80-0 |
| MW: | 242.23 D |
31,00 €
Molsidomine
Artikelnummer: Cay82200-100
Molsidomine is a NO-releasing prodrug. Liver esterases convert molsidomine to the active metabolite, SIN-1 (half-life in plasma is 1-2 hours), which then releases NO.Formal Name: N-(ethoxycarbonyl)-3-(4-morpholinyl)-sydnone imine. CAS Number: 25717-80-0. Synonyms: Corvaton, Morsydomine. Molecular Formula: C9H14N4O4....
| Schlagworte: | Corvaton, Morsydomine, N-(ethoxycarbonyl)-3-(4-morpholinyl)-sydnone imine |
| Anwendung: | NO-releasing prodrug |
| CAS | 25717-80-0 |
| MW: | 242.2 D |
ab 20,00 €
Molsidomine
Artikelnummer: LKT-M5746.1
An orally active vasodilator that requires hepatic metabolism for activity.
| Anwendung: | Metabolic studies |
| CAS | 25717-80-0 |
| MW: | 242,23 D |
ab 83,00 €
