Zu "2561494-78-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
UNC7145
Artikelnummer: Cay40166-1
UNC7145 is an inactive derivative of the histone-lysine N-methyltransferase NSD2 inhibitor UNC6934 that has been used as a negative control for the histone methyltransferase activity of NSD2.Formal Name:...
| Schlagworte: | 3,4-dihydro-N-(1-methylethyl)-3-oxo-N-[[4-[(4-pyrimidinylamino)carbonyl]phenyl]methyl]-2H-1,4-benzoxazine-7-carboxamide |
| Anwendung: | Inactive UNC6934 derivative, negative control |
| CAS | 2561494-78-6 |
| MW: | 445.5 D |
ab 44,00 €
UNC7145
Artikelnummer: TGM-T84674-10mg
Description: UNC6934 Negative Control (Axon 3591) is a chemically related compound that serves as a negative control for UNC6934, a potent and selective chemical probe that specifically targets the N-terminal PWWP (PWWP1) domain of NSD2. Target: Others. Smiles: CC(C)N(Cc1ccc(cc1)C(=O)Nc1ccncn1)C(=O)c1ccc2NC(=O)COc2c1
| Schlagworte: | UNC-7145, UNC 7145, UNC7145 |
| Anwendung: | Inactive UNC6934 derivative, negative control |
| CAS | 2561494-78-6 |
| MW: | 445.4705 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
