Zu "254877-67-3" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Ataciguat
Ataciguat

Artikelnummer: Cay16371-1

Soluble guanylate cyclase (sGC) is the primary cellular receptor for NO. NO binds and activates a heme group in sGC, initiating the conversion of GTP to the second messenger cGMP. cGMP subsequently mediates a number of signaling cascades leading to vasorelaxation and inhibiting smooth muscle proliferation, leukocyte...
Schlagworte: HMR 1766, 5-chloro-2-[[(5-chloro-2-thienyl)sulfonyl]amino]-N-[4-(4-morpholinylsulfonyl)phenyl]-benzamide
Anwendung: sGC, oxidized, heme-free, form, activator
CAS 254877-67-3
MW: 576.5 D
ab 122,00 €
Bewerten
Ataciguat
Ataciguat

Artikelnummer: TGM-T21607-100mg

Description: Ataciguat (HMR-1766) (HMR-1766) is a potent and specific soluble guanylate cyclase (sGC) activator. Target: Others, Guanylate cyclase. Smiles: N(S(=O)(=O)C1=CC=C(Cl)S1)C2=C(C(NC3=CC=C(S(=O)(=O)N4CCOCC4)C=C3)=O)C=C(Cl)C=C2. References: Martinelli AM, et, al. In Endothelial Cells, the Activation or...
Schlagworte: HMR-1766
Anwendung: sGC, oxidized, heme-free, form, activator
CAS 254877-67-3
MW: 576.49 D
ab 42,00 €
Bewerten