Zu "253449-04-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Wiskostatin
Artikelnummer: TGM-T2164-100mg
Description: Wiskostatin is a selective inhibitor of N-WASP, a ubiquitously expressed member of the Wiskott-Aldrich Syndrome protein (WASp) family that regulates actin polymerization. Target: Others. Smiles: CN(C)CC(O)Cn1c2ccc(Br)cc2c2cc(Br)ccc12. References: Guerriero CJ, Weisz OA. Am J Physiol Cell Physiol. 2007...
| Anwendung: | N-WASP inhibitor |
| CAS | 253449-04-6 |
| MW: | 426.15 D |
ab 40,00 €
Wiskostatin
Artikelnummer: Cay15047-1
Wiskott-Aldrich syndrome proteins (WASPs) regulate the actin cytoskeleton by directly interacting with actin in the Arp2/3 complex. As a result, they have essential functions in diverse cellular processes, including phagocytosis, cell motility, and membrane trafficking. Wiskostatin is a cell-permeable, selective...
| Schlagworte: | 3,6-dibromo-alpha-[(dimethylamino)methyl]-9H-carbazole-9-ethanol |
| Anwendung: | N-WASP inhibitor |
| CAS | 253449-04-6 |
| MW: | 426.1 D |
ab 94,00 €
