Zu "252025-52-8" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Adjudin
Adjudin

Artikelnummer: Cay22939-1

Adjudin is a derivative of ionidamine that inhibits human spermatozoa capacitance, potentially by blocking chloride channels. It inhibits spermatozoa hyperactivated motility and the acrosome reaction and prevents sperm-egg fusion in zona-free hamster eggs. It also disrupts Sertoli-germ cell junctions by increasing...
Schlagworte: AF-2364, 1-[(2,4-dichlorophenyl)methyl]-1H-indazole-3-carboxylic acid, hydrazide
Anwendung: Spermatozoa capacitance inhibitor, chloride channel blocker
CAS 252025-52-8
MW: 335.2 D
ab 44,00 €
Bewerten
Adjudin
Adjudin

Artikelnummer: TGM-T2498-100mg

Description: Adjudin (AF-2364) is a small molecule compound known to possess antispermatogenic function, attenuates microglia activation by suppression of the NF-kappaB pathway. Target: Chloride channel, Mitochondrial Metabolism. Smiles: NNC(=O)c1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12. References: Mruk DD. Trends Endocrinol...
Schlagworte: AF-2364
CAS 252025-52-8
MW: 335.19 D
ab 48,00 €
Bewerten