Zu "251647-53-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
2'-O-MOE-A(Bz)-3'-Phosphoramidite
Artikelnummer: Cay43573-1
2'-O-MOE-A(Bz)-3'-phosphoramidite is a nucleoside building block that has been used in the synthesis of nucleoside dimer phosphoramidites. InChI:...
| Schlagworte: | 3'-[2-cyanoethyl N,N-bis(1-methylethyl) phosphoramidite] N-benzoyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-... |
| Anwendung: | Nucleoside building block |
| CAS | 251647-53-7 |
| MW: | 932.03 D |
ab 51,00 €
2'-O-MOE-A(Bz)-3'-phosphoramidite
Artikelnummer: TGM-TNU0958-100mg
Description: 2'-O-MOE-A(Bz)-3'-phosphoramidite is a Nucleoside Phosphoramidite,Nucleoside Derivative - 2'-Modified nucleoside,. Target: Others. Smiles: C(OC[C@@H]1[C@@H](OP(N(C(C)C)C(C)C)OCCC#N)[C@@H](OCCOC)[C@@H](O1)N2C=3C(N=C2)=C(NC(=O)C4=CC=CC=C4)N=CN3)(C5=CC=C(OC)C=C5)(C6=CC=C(OC)C=C6)C7=CC=CC=C7
| CAS | 251647-53-7 |
| MW: | 932.01 D |
ab 30,00 €
