Zu "2478-38-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Acetosyringone
Artikelnummer: TGM-T5592-1g
Description: Acetosyringone (Acetosyringenin)(AS) is a phenol secreted by wounded plant tissues.Acetosyringone is a phenolic natural product with analgesic, antipyretic and anti-inflammatory actions. Target: Others. Smiles: O(C)C1=C(O)C(OC)=CC(C(C)=O)=C1. References: Srinivasan R , Gothandam K M . Synergistic Action...
| Schlagworte: | Acetosyringenin |
| CAS | 2478-38-8 |
| MW: | 196.2 D |
ab 31,00 €
Acetosyringone
Artikelnummer: Cay23224-1
Acetosyringone is a phenol secreted by wounded plant tissues. It induces expression of virulence A genes and chemotaxis in A. tumefaciens strains that contain a tumor-inducing plasmid used to transfer genetic information to plant cells. Acetosyringone is widely used to increase efficacy of genetic transformation for...
| Schlagworte: | 3',5'-Dimethoxy-4'-hydroxyacetophenone, 1-(4-hydroxy-3,5-dimethoxyphenyl)-ethanone |
| Anwendung: | Plant genetic transformation auxiliary |
| CAS | 2478-38-8 |
| MW: | 196.2 D |
ab 41,00 €
