Zu "247150-73-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
N-Oleoyl Glutamine
Artikelnummer: Cay28922-1
N-Oleoyl glutamine is an endogenous N-acyl amine. It is both formed and degraded by peptidase M20 domain-containing 1 (PM20D1), a factor secreted by thermogenic adipose cells. N-Oleoyl glutamine (50 µM) induces mitochondrial uncoupling to increase respiration in C2C12 cells by 64%. It inhibits capsaicin-induced...
| Schlagworte: | N2-[(9Z)-1-oxo-9-octadecen-1-yl]-L-glutamine |
| Anwendung: | Endogenous N-acyl amine |
| CAS | 247150-73-8 |
| MW: | 410.6 D |
ab 89,00 €
N-Oleoyl Glutamine
Artikelnummer: TGM-T36064-100mg
Description: N-Oleoyl Glutamine (Oleoyl-L-glutamine) is an N-acyl amino acid involved in the regulation of PM20D1 and antagonizes TRPV1 of the transient receptor potential (TRP) calcium channel. Target: TRP/TRPV Channel. Smiles: [C@H](NC(CCCCCCC/C=C\CCCCCCCC)=O)(CCC(N)=O)C(O)=O. References: Long, J.Z., Svensson,...
| Schlagworte: | Oleoyl-L-glutamine |
| Anwendung: | Endogenous N-acyl amine |
| CAS | 247150-73-8 |
| MW: | 410.59 D |
ab 102,00 €
