Zu "24587-37-9" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
Dipeptide 2
Artikelnummer: Cay45932-1
Dipeptide 2 is an inhibitor of angiotensin-converting enzyme (ACE, IC50 = 1.4 µM). It reduces systolic blood pressure in spontaneously hypertensive rats at 100 mg/kg. Formulations containing dipeptide 2 have been used in cosmetics and skin care products.. SMILES: CC(C)[C@H](N)C(N[C@H](C(O)=O)CC1=CNC2=CC=CC=C12)=O....
| Schlagworte: | Dipeptide VW, L-Val-L-Trp-OH, Valyl-tryptophan, L-valyl-L-tryptophan |
| Anwendung: | ACE inhibitor |
| CAS | 24587-37-9 |
| MW: | 303.36 D |
ab 35,00 €
N-Valyltryptophan
Artikelnummer: TGM-T20540-1g
Description: N-Valyltryptophan (Val-trp) is an incomplete breakdown product of protein catabolism or protein digestion. Target: Others. Smiles: CC(C)[C@H](N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O. References: Li Y, Wang F, Zhang PZ, Yang M. [Chemical Constituents from Periplaneta americana]. Zhong Yao Cai. 2015...
| Schlagworte: | Val-trp, L-Valyl-L-tryptophan |
| CAS | 24587-37-9 |
| MW: | 303.36 D |
37,00 €
Dipeptide-2
Artikelnummer: CSB-DT1692.1
Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
| Schlagworte: | Val-Trp, VW |
| Anwendung: | Cosmetic peptide |
| CAS | 24587-37-9 |
| MW: | 303.361 D |
165,00 €
