Zu "2447-57-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Sulfadoxine
Artikelnummer: TGM-T0836-500mg
Description: Sulfadoxine (Sulphadoxine) is a broad-spectrum sulfanilamide and a synthetic analog of para-aminobenzoic acid (PABA) with bacteriostatic and antimalarial properties. Target: Parasite, HIV Protease, Antibiotic, Autophagy, DHFR. Smiles: N(S(=O)(=O)C1=CC=C(N)C=C1)C=2C(OC)=C(OC)N=CN2. References: Raman...
| Schlagworte: | Sulphadoxine |
| CAS | 2447-57-6 |
| MW: | 310.33 D |
29,00 €
Sulfadoxin
Artikelnummer: Cay21488-10
Sulfadoxin is a sulfonamide antibiotic that inhibits dihydropteroate synthetase (DHPS), an enzyme involved in folic acid (Cay-20515) synthesis. Sulfadoxin competes with 4-aminobenzoate (PABA), the native substrate of DHPS, and inhibits PABA incorporation into folic acid. Folate is essential for purine and pyrimidine...
| Schlagworte: | Ro 4-4393, 4-amino-N-(5,6-dimethoxy-4-pyrimidinyl)-benzenesulfonamide |
| Anwendung: | Antibacterial, antimalarial, folic acid biosynthesis inhibitor |
| CAS | 2447-57-6 |
| MW: | 310.3 D |
ab 56,00 €
Sulfadoxine
Artikelnummer: LKT-S8144.1
An antibacterial agent.
| Anwendung: | Antibacterial, Antimalarial Dihydropteroate synthase inhibitor |
| CAS | 2447-57-6 |
| MW: | 310.33 D |
ab 83,00 €
