Zu "24425-56-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Hexylglutathione
Artikelnummer: Cay29695-100
Hexylglutathione is a mitochondrial membrane-bound microsomal glutathione S-transferase 1 (mtMGST1) inhibitor (IC50 = 0.48 mM). It also inhibits the dopachrome tautomerase activity of macrophage migration inhibitory factor (MIF, IC50 = 3.3 mM). It has been used as an affinity chromatography ligand to purify...
| Schlagworte: | NSC 131114, S-Hexylglutathione, L-gamma-glutamyl-S-hexyl-L-cysteinyl-glycine |
| Anwendung: | mtMGST1 inhibitor |
| CAS | 24425-56-7 |
| MW: | 391.5 D |
ab 122,00 €
Hexylglutathione
Artikelnummer: TGM-T27541-100mg
Description: Hexylglutathione, a glutathione-S-transferase inhibitor, is used to study the effects of phase II enzymes and glutathione. Smiles: CCCCCCSCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O. References: Swope MD, Sun HW, Klockow B, Blake P, Lolis E. Macrophage migration inhibitory factor interactions with glutathione...
| Schlagworte: | NSC 131114, NSC-131114, NSC131114, S-Hexylglutathione |
| Anwendung: | mtMGST1 inhibitor |
| CAS | 24425-56-7 |
| MW: | 391.48 D |
ab 271,00 €
