Zu "24305-27-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Protirelin
Artikelnummer: TGM-T6956-10mg
Description: Protirelin (Thyroliberin) is a tripeptide that stimulates the release of thyrotropin and prolactin. Target: Thyroid hormone receptor(THR), Endogenous Metabolite. Smiles: C([C@H](CC1=CN=CN1)NC(=O)[C@@H]2CCC(=O)N2)(=O)N3[C@H](C(N)=O)CCC3. References: Van Sinay E,etal.Evolutionarily conserved TRH...
| Schlagworte: | Thyroliberin, TRF, TRH, Synthetic thyrotropin-releasing hormone, pGlu-His-Pro-NH2, Lopremone |
| Anwendung: | Targets thyrotropin-releasing hormone receptor (TRHR) |
| CAS | 24305-27-9 |
| MW: | 362.38 D |
ab 46,00 €
Thyrotropin-Releasing Hormone
Artikelnummer: Cay22917-10
Thyrotropin-releasing Hormone (TRH) is a tropic hormone that stimulates release of thyroid-stimulating hormone (TSH) and prolactin. It binds to the human TRH receptor (TRHR) expressed in CHO cells and to rat TRHR in rat brain membranes (IC50s = 25 and 198 nM, respectively). TRH (1 µM) decreases polyphosphoinositide...
| Schlagworte: | pGlu-His-Pro amide, Thyroliberin, Thyrotropin-Releasing Factor, TRF, TRH, TSH-releasing Hormone,... |
| Anwendung: | TRHR agonist |
| CAS | 24305-27-9 |
| MW: | 362.4 D |
ab 45,00 €
