Zu "24198-95-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Juvenile Hormone III
Artikelnummer: Cay19646-10
Juvenile hormone III is an acyclic sesquiterpenoid that regulates diverse processes in insects, including adult transition of larvae and oogenesis in adult females. It activates the juvenile hormone receptor, known as methoprene-tolerant, with a Kd value of 2.9 nM. Juvenile hormone III can be synthesized from...
| Schlagworte: | trans-trans-10,11-Epoxyfarnesenic Acid methyl ester, (2E,6E)-9-(3,3-dimethyl-2-oxiranyl)-3,7-dimethyl-2,6-nonadienoic... |
| Anwendung: | Methoprene-tolerant receptor agonist |
| CAS | 24198-95-6 |
| MW: | 266.4 D |
ab 60,00 €
(Rac)-Juvenile hormone III
Artikelnummer: TGM-T83531-10mg
Description: (Rac)-Juvenile hormone III, derived from farnesoic acid, represents the most prevalent homologue of juvenile hormones [1]. Smiles: C(C/C(=C/CC/C(=C/C(OC)=O)/C)/C)C1C(C)(C)O1
| CAS | 24198-95-6 |
| MW: | 266.38 D |
ab 93,00 €
