Zu "2418670-70-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ML-SA5
Artikelnummer: Cay38326-1
ML-SA5 is an agonist of transient receptor potential mucolipin 1 (TRPML1). It activates whole-endolysosome TRPML1-mediated current (IML1) in isolated vacuoles that were enlarged by vacuolin-1 (Cay-20425) (EC50 = 333 nM). ML-SA5 (3 µM) is cytotoxic to MeWo and M12 melanoma cells but not normal melanocytes. It induces...
| Schlagworte: | Mucolipin Synthetic Agonist 5, N4-[3-chloro-2-(1-piperidinyl)phenyl]-N1,N1-dimethyl-1,4-benzenedisulfonamide |
| Anwendung: | TRPML1 agonist |
| CAS | 2418670-70-7 |
| MW: | 458 D |
ab 45,00 €
ML-SA5
Artikelnummer: TGM-T60036-100mg
Description: ML-SA5 is an MCOLN1 agonist and arrests autophagic flux by perturbing fusion between autophagosomes and lysosomes. Target: Autophagy. Smiles: CN(C)S(=O)(=O)c1ccc(cc1)S(=O)(=O)Nc1cccc(Cl)c1N1CCCCC1. References: Qi J, et al. MCOLN1/TRPML1 finely controls oncogenic autophagy in cancer by mediating zinc...
| Anwendung: | TRPML1 agonist |
| CAS | 2418670-70-7 |
| MW: | 457.99 D |
ab 32,00 €
