Zu "2416-19-5" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
cis-7-Hexadecenoic Acid
cis-7-Hexadecenoic Acid

Artikelnummer: Cay10007290-5

Mono-unsaturated fatty acids are components of the cellular membranes of autotrophic bacteria. The specific composition and abundance of membrane fatty acids can be used to identify specific genera of bacterial populations in natural environments (e.g., mining lakes, etc.). Mono-unsaturated fatty acids are...
Schlagworte: 7Z-hexadecenoic acid
Anwendung: Bioactive lipid assays
CAS 2416-19-5
MW: 254.4 D
ab 85,00 €
Bewerten
Hypogeic acid
Hypogeic acid

Artikelnummer: TGM-T84533-10mg

Description: Hypogeic acid is isolable from cultures of autotrophic bacteria linked to sulfate accumulation in biofilters [1]. Target: Others. Smiles: C(/C=C\CCCCCCCC)CCCCC(O)=O
CAS 2416-19-5
MW: 254.41 D
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Bewerten