Zu "2414254-34-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Exatecan-amide-cyclopropanol
Artikelnummer: Cay44470-1
Exatecan-amide-cyclopropanol is a derivative of the DNA topoisomerase I inhibitor exatecan (Cay-35452) that has been used as a building block in the synthesis of antibody-drug conjugates (ADCs) with anticancer activity. Formal Name:...
| Schlagworte: | N-[(1S,9S)-9-ethyl-5-fluoro-2,3,9,10,13,15-hexahydro-9-hydroxy-4-methyl-10,13-dioxo-1H,12H-benzo[de]pyrano[3',4':6,7]indol... |
| Anwendung: | Exatecan derivative, ADC building block |
| CAS | 2414254-34-3 |
| MW: | 519.53 D |
ab 61,00 €
Exatecan-amide-cyclopropanol
Artikelnummer: TGM-T63624-25mg
Description: Exatecan-amide-cyclopropanol is an anticancer agent that inhibits the proliferation of SK-BR-3 cells (IC50: 0.12 nM) and U87 cells (IC50: 0.23 nM). Target: Others, ADC Cytotoxin. Smiles: CC[C@@]1(O)C(=O)OCc2c1cc1-c3nc4cc(F)c(C)c5CC[C@H](NC(=O)C6(O)CC6)c(c3Cn1c2=O)c45
| CAS | 2414254-34-3 |
| MW: | 519.52 D |
ab 500,00 €
