Zu "2398-96-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Tolnaftate
Artikelnummer: TGM-T1094-1g
Description: Tolnaftate (NP-27) is a synthetic antifungal agent used to treat skin infections caused by fungi. Target: Antifungal, Hedgehog/Smoothened. Smiles: O(C(N(C)C1=CC(C)=CC=C1)=S)C2=CC3=C(C=C2)C=CC=C3. References: Barrett-Bee K, Dixon G. Acta Biochim Pol. 1995,42(4):465-79.
| Schlagworte: | NP-27, Tinactin, Sporiline, Tonoftal |
| CAS | 2398-96-1 |
| MW: | 307.41 D |
31,00 €
Tolnaftate
Artikelnummer: Cay21446-1
Tolnaftate is a thiocarbamate antifungal agent. It is active against clinical isolates of the dermatophytes T. rubrum, T. mentagraphytes, T. verrucosum, E. floccosum, and M. canis (MIC50s = 50, 100, 6, 50, and 50 ng/ml, respectively), as well as 18 additional yeast and filamentous fungi species (MIC = 0.003-0.8...
| Schlagworte: | NSC 233648, SCH 10144, N-methyl-N-(3-methylphenyl)-carbamothioic acid, O-2-naphthalenyl ester |
| Anwendung: | Antifungal, ergosterol biosynthesis inhibitor |
| CAS | 2398-96-1 |
| MW: | 307.4 D |
ab 53,00 €
