Zu "23918-98-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
D-Eritadenine
Artikelnummer: Cay21747-1
D-Eritadenine is an adenosine analog and a potent, reversible inhibitor of S-adenosylhomocysteine hydrolase (SAAH, IC50 = 7 nM). It inhibits growth of C. parvum parasites (MIC50 = 3 µM) without exhibiting cytotoxicity in HCT-8 cells (CC50 = >1 mM). Dietary administration of D-eritadenine (50 mg/kg) increases liver...
| Schlagworte: | 6-amino-alphaR,betaR-dihydroxy-9H-purine-9-butanoic acid |
| Anwendung: | Adenosylhomocysteinase inhibitor |
| CAS | 23918-98-1 |
| MW: | 253.2 D |
ab 69,00 €
Eritadenine
Artikelnummer: TGM-T25385-10mg
Description: Eritadenine is a potent S-adenosyl-L-homocysteine hydrolase (SAHH) inhibitor, decreasing total cholesterol levels in plasma. Target: Others. Smiles: C([C@H]([C@H](C(O)=O)O)O)N1C=2C(N=C1)=C(N)N=CN2. References: Afrin S, Rakib MA, Kim BH, Kim JO, Ha YL. Eritadenine from Edible Mushrooms Inhibits Activity...
| Schlagworte: | Lentinacin, Lentysine, D-Eritadenine |
| Anwendung: | Adenosylhomocysteinase inhibitor |
| CAS | 23918-98-1 |
| MW: | 253.21 D |
ab 108,00 €
