Zu "2379-57-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
DNQX
Artikelnummer: TGM-T7304-100mg
Description: DNQX (FG 9041) is a competitive, non-NMDA glutamate receptor antagonist (IC50s = 0.5 and 0.1 µM for AMPA and kainate receptors, respectively). Target: iGluR, GluR. Smiles: [O-][N+](=O)c1cc2[nH]c(=O)c(=O)[nH]c2cc1[N+]([O-])=O. References: Muller D , Joly M , Lynch G . Contributions of quisqualate and...
| Schlagworte: | FG 9041 |
| CAS | 2379-57-9 |
| MW: | 252.14 D |
ab 49,00 €
DNQX
Artikelnummer: Cay14583-50
DNQX is a competitive, non-NMDA glutamate receptor antagonist (IC50s = 0.5 and 0.1 µM for AMPA and kainate receptors, respectively versus IC50 = 40 µM for NMDA receptors). This compound has been used to specifically target AMPA and kainate receptor responses and thus differentiate from that of NMDA receptors. DNQX...
| Schlagworte: | 6,7-Dinitroquinoxaline-2,3-dione, FG 9041, 1,4-dihydro-6,7-dinitro-2,3-quinoxalinedione |
| Anwendung: | Non-NMDA glutamate receptor antagonist |
| CAS | 2379-57-9 |
| MW: | 252.1 D |
ab 52,00 €
