Zu "2377858-38-1" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
SCR130
SCR130

Artikelnummer: Cay37779-1

SCR130 is an inhibitor of non-homologous end joining (NHEJ) and a derivative of the DNA ligase IV inhibitor SCR7 (Cay-18015). It selectively inhibits DNA ligase IV- over ligase I- or ligase III-mediated end-joining in cell-free assays when used at a concentration of 200 µM. SCR130 is cytotoxic to NALM6 and Reh...
Schlagworte: 2,4-bis(4-chlorophenyl)-8-thioxo-1,7,9-triazaspiro[4.5]dec-1-ene-6,10-dione
Anwendung: NHEJ (non-homologous end joining) inhibitor
CAS 2377858-38-1
MW: 418.3 D
ab 42,00 €
Bewerten
SCR130
SCR130

Artikelnummer: TGM-T9150-100mg

Description: SCR130 (1,7,9-Triazaspiro[4.5]dec-1-ene-6,10-dione, 2,4-bis(4-chlorophenyl)-8-thioxo-) is enzyme inhibition, antiproliferative effects and antifungal activity. Target: Others, Apoptosis, DNA/RNA Synthesis. Smiles: Clc1ccc(cc1)C1CC(=NC11C(=O)NC(=S)NC1=O)c1ccc(Cl)cc1. References: Gopinatha V K , Swarup...
Schlagworte: 1,7,9-Triazaspiro[4.5]dec-1-ene-6,10-dione, 2,4-bis(4-chlorophenyl)-8-thioxo-
Anwendung: NHEJ (non-homologous end joining) inhibitor
CAS 2377858-38-1
MW: 418.3 D
ab 52,00 €
Bewerten