Zu "2364554-48-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Aficamten
Artikelnummer: TGM-T9258-100mg
Description: Aficamten is a Next-Generation Cardiac Myosin Inhibitor for the Treatment of Hypertrophic Cardiomyopathy. Target: Others. Smiles: CCc1nc(no1)-c1ccc2[C@@H](CCc2c1)NC(=O)c1cnn(C)c1
| Anwendung: | Targets myosin heavy chain 6/7 (MYH6_7) |
| CAS | 2364554-48-1 |
| MW: | 337.38 D |
ab 67,00 €
Aficamten
Artikelnummer: Cay36304-1
Aficamten is an inhibitor of cardiac myosin ATPase (IC50 = 1.26 µM for the bovine enzyme). It reduces fractional shortening in isolated rat cardiac ventricular myocytes (IC50 = 7.9 µM) and in rats in a dose-dependent manner.Formal Name:...
| Schlagworte: | CK-274, CK-3773274, N-[(1R)-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,3-dihydro-1H-inden-1-yl]-1-methyl-1H-pyrazole-4-carboxamide |
| Anwendung: | Cardiac myosin ATPase inhibitor |
| CAS | 2364554-48-1 |
| MW: | 337.4 D |
ab 132,00 €
