Zu "23465-76-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Caroverine
Artikelnummer: TGM-T9133L-100mg
Description: Caroverine is a potential chemotherapeutical agent in HNSCC cell lines. Target: Others. Smiles: C(CN(CC)CC)N1C=2C(N=C(CC3=CC=C(OC)C=C3)C1=O)=CC=CC2. References: Haymerle G, Thurnher D, Kadletz L, Stanisz I, Brunner M, Kotowski U, Enzenhofer E, Heiduschka G. Assessment of caroverine as a potential...
| Schlagworte: | P 201-1 |
| Anwendung: | Antioxidant |
| CAS | 23465-76-1 |
| MW: | 365.47 D |
ab 1.971,00 €
Caroverin
Artikelnummer: CDX-C0260-M010
Synthetic. Chemical. CAS: 23465-76-1. Formula: C22H27N3O2. MW: 365.47. Synthetic. Quinoxaline compound, originally developed as a spasmolytic drug. Acts as an N-type calcium channel blocker, competitive AMPA receptor antagonist, and non-competitive NMDA receptor antagonist. Antioxidant agent through partial...
| Schlagworte: | 1-[2-(Diethylamino)ethyl]-3-(p-methoxybenzyl)-2-quinoxalone, Spadon, Spasmium |
| Anwendung: | Antioxidant, Tinnitus treatment |
| CAS | 23465-76-1 |
| MW: | 365,47 D |
ab 122,00 €
