Zu "2331255-53-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ABC99
Artikelnummer: Cay25858-1
ABC99 is an N-hydroxyhydantoin (NHH) carbamate that inhibits the Wnt-deacylating enzyme NOTUM (IC50 = 13 nM). It preserves Wnt3A signaling in the presence of NOTUM (EC50 = 89 nM in a cell-based reporter assay).Formal Name:...
| Schlagworte: | 7-(4-chlorobenzyl)-1,3-dioxohexahydroimidazo[1,5-a]pyrazin-2(3H)-yl-2,3-dihydro-4H-benzo[b][1,4]oxazine-4-carboxylate |
| Anwendung: | NOTUM inhibitor |
| CAS | 2331255-53-7 |
| MW: | 456.9 D |
ab 111,00 €
ABC99
Artikelnummer: TGM-T23602-100mg
Description: ABC99 is a selective irreversible inhibitor of the wnt-deacylating enzyme. ABC99 inhibited NOTUM (IC50: 13 nM). It also showed excellent selectivity across the serine hydrolase family. Target: Wnt/beta-catenin. Smiles: Clc1ccc(CN2CCN3C(C2)C(=O)N(OC(=O)N2CCOc4ccccc24)C3=O)cc1. References: Suciu RM, et...
| Schlagworte: | ABC 99, ABC-99 |
| CAS | 2331255-53-7 |
| MW: | 456.88 D |
ab 175,00 €
