Zu "23288-49-5" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Probucol
Artikelnummer: TGM-T0254-100mg
Description: Probucol (DH-581), an anti-hyperlipidemic drug, can lower the level of cholesterol in the bloodstream by increasing the LDL catabolic rate. Target: Lipid, ABC, Virus Protease. Smiles: CC(C)(SC1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C)SC1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C. References: Jeon SM, et al. J Biochem...
| Schlagworte: | DH-581 |
| CAS | 23288-49-5 |
| MW: | 516.84 D |
ab 37,00 €
Probucol
Artikelnummer: Cay15043-50
Probucol is a potent antioxidant that inhibits the oxidation of cholesterol in LDL, which prevents the formation of macrophage-derived foam cells that lead to atherosclerotic vascular lesions. Probucol's use is limited, however, because it leads to the reduction of HDL cholesterol as well. Probucol inhibits up to...
| Schlagworte: | DH 581, Lorelco, NSC 652160, NSC 86225, 4,4'-[(1-methylethylidene)bis(thio)]bis[2,6-bis(1,1-dimethylethyl)-phenol |
| Anwendung: | Antioxidant, Antidyslipidemic agent |
| CAS | 23288-49-5 |
| MW: | 516.8 D |
ab 85,00 €
![Probucol-[13C3]](/custom/plugins/NetiThemeBiomol/Resources/Themes/Frontend/Biomol/frontend/_public/src/img/no-picture.jpg "Probucol-[13C3]")
Probucol-[13C3]
Artikelnummer: ISO-4032.5
13C-labeled. Isotope incorporation: ?99%
| Schlagworte: | Carbon-13-labelled, CAS of labelled compound: 1173019-29-8 |
| Anwendung: | Antioxidant, antidyslipidemic agent, LC/MS internal standard |
| CAS | 23288-49-5 |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Probucol
Artikelnummer: ISO-4032UNL.1
| Schlagworte: | unlabelled |
| CAS | 23288-49-5 |
| MW: | 517 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
