Zu "2304621-31-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
IMT1
Artikelnummer: TGM-T8841-100mg
Description: IMT1 (Propanamide, N,N-dimethyl-2-[[4-(2-methylphenyl)-2-oxo-2H-1-benzopyran-7-yl]oxy]-) has anticancer activity. Target: Others, DNA/RNA Synthesis, Mitochondrial Metabolism. Smiles: CC(Oc1ccc2c(cc(=O)oc2c1)-c1ccccc1C)C(=O)N(C)C. References: WO2019057821
| Schlagworte: | LDC195943(IMT1), Propanamide, N,N-dimethyl-2-[[4-(2-methylphenyl)-2-oxo-2H-1-benzopyran-7-yl]oxy]- |
| CAS | 2304621-31-4 |
| MW: | 351.4 D |
ab 70,00 €
IMT1
Artikelnummer: Cay43029-10
IMT1 is an inhibitor of mitochondrial RNA polymerase (POLRMT). It selectively inhibits POLRMT transcription over six other RNA polymerases at 1 µM. IMT1 (0.05-10 µM) decreases mitochondrial mRNA transcripts and mitochondrial DNA levels in HeLa cervical cancer cells. It reduces oxygen flux in HeLa cells when used at...
| Schlagworte: | LDC-195943, N,N-dimethyl-2-[[4-(2-methylphenyl)-2-oxo-2H-1-benzopyran-7-yl]oxy]-propanamide |
| Anwendung: | POLRMT inhibitor |
| CAS | 2304621-31-4 |
| MW: | 351.4 D |
ab 120,00 €
