Zu "2301865-01-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(S)-DO271
Artikelnummer: Cay30038-500
(S)-DO271 is an inactive control for the alpha/beta-hydrolase domain-containing protein 12 (ABHD12) inhibitor DO264 (Cay-29402). Unlike DO264, (S)-DO271 does not inhibit ABHD12-dependent hydrolysis of lysophosphatidylserine (lyso-PS) in mouse brain membrane lysates when used at a concentration of 1 µM or modify...
| Schlagworte: | N-[(3S)-1-[3-chloro-4-[2-chloro-4-(trifluoromethoxy)phenoxy]-2-pyridinyl]-3-piperidinyl]-N'-3-pyridinyl-thiourea |
| Anwendung: | Inactive DO264 control |
| CAS | 2301865-01-8 |
| MW: | 558.4 D |
ab 51,00 €
(S)-DO271
Artikelnummer: TGM-T69694-1mg
Description: (S)-DO271 is an inactive control for the alpha/beta-hydrolase domain-containing protein 12 (ABHD12) inhibitor DO264. Target: Others. Smiles: ClC1=C(N=CC=C1OC2=C(Cl)C=C(OC(F)(F)F)C=C2)N3C[C@@H](NC(NC=4C=CC=NC4)=S)CCC3
| Anwendung: | Inactive DO264 control |
| CAS | 2301865-01-8 |
| MW: | 558.4 D |
ab 106,00 €
