Zu "223499-30-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
YM-58483
Artikelnummer: Cay13246-1
Calcium release-activated calcium (CRAC) channels mediate sustained calcium influx in electrically non-excitable cells. CRAC channels are activated by the release of calcium from intracellular stores, as induced by inositol trisphosphate. CRAC channel activation is essential for the activation of leukocytes and the...
| Schlagworte: | BTP 2, N-[4-[3,5-bis(trifluoromethyl)-1H-pyrazol-1-yl]phenyl]-4-methyl-1,2,3-thiadiazole-5-carboxamide |
| Anwendung: | CRAC channel inhibitor |
| CAS | 223499-30-7 |
| MW: | 421.3 D |
ab 54,00 €
YM-58483
Artikelnummer: TGM-T3651-5mg
Description: YM-58483 (BTP2) is a specific and effective inhibitor of CRAC channels and subsequent Ca2+ signals. Target: Calcium Channel. Smiles: Cc1nnsc1C(=O)Nc1ccc(cc1)-n1nc(cc1C(F)(F)F)C(F)(F)F. References: Ohga K, et al. Int Immunopharmacol. 2008, 8(13-14):1787-92.
| Schlagworte: | YM 58483, BTP2 |
| Anwendung: | CRAC channel inhibitor |
| CAS | 223499-30-7 |
| MW: | 421.32 D |
ab 30,00 €
