Zu "2230198-02-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
PF-06882961
Artikelnummer: Cay30657-10
PF-06882961 is an agonist of the glucagon-like peptide 1 receptor (GLP-1R). It induces cAMP accumulation in CHO cells expressing the human receptor (EC50 = 0.71 nM). Oral administration of PF-06882961 enhances insulin secretion in a glucose tolerance test, and subcutaneous administration decreases food intake in...
| Schlagworte: | Danuglipron,... |
| Anwendung: | GLP-1R agonist |
| CAS | 2230198-02-2 |
| MW: | 555.6 D |
ab 97,00 €
PF-06882961
Artikelnummer: TGM-T12431-100mg
Description: PF-06882961 is an orally bioavailable glucagon-like peptide-1 receptor (GLP-1R) agonist. Target: Glucagon Receptor. Smiles: OC(C1=CC=C(N=C(CN2CCC(C3=NC(OCC4=CC=C(C#N)C=C4F)=CC=C3)CC2)N5C[C@H]6OCC6)C5=C1)=O. References: 20th SCI/RSC Medicinal Chemistry Symposium.
| Anwendung: | Targets glucagon-like peptide 1 receptor (GLP1R) |
| CAS | 2230198-02-2 |
| MW: | 555.6 D |
ab 40,00 €
