Zu "22204-53-1" wurden 5 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(+)-Naproxen
Artikelnummer: Cay70290-1
An NSAID and COX inhibitor, inhibits COX-1 and COX-2 in COS-1 cells expressing the human enzymes (IC50s = 4.8 and 28.4 µM, respectively), inhibits TXB2 and PGE2 production ex vivo in isolated rat blood (IC50s = 5 and 13 µM, respectively). Formulation: A crystalline solid. InChI:...
| Schlagworte: | (S)-Naproxen, CG 3117, (aS)-6-methoxy-a-methyl-2-naphthaleneacetic acid |
| Anwendung: | NSAID, COX inhibitor |
| CAS | 22204-53-1 |
| MW: | 230.3 D |
ab 30,00 €
D,L-Naproxen
Artikelnummer: LKT-N0062.25
NSAID, COX-1/2 inhibitor.
| Schlagworte: | Artagen, Danaprox, Nafasol, Sutolin, naproxen, (+)-(S)-6-Methoxy-alpha-methyl-2-naphthaleneacetic acid |
| Anwendung: | Anti-inflammatory agent |
| CAS | 22204-53-1 |
| MW: | 230,26 D |
ab 134,00 €
D-Naproxen
Artikelnummer: LKT-N0061.25
A non-steroidal anti-inflammatory agent found to significantly inhibit NNK activation in lung tissues.
| Anwendung: | Anti-inflammatory agent |
| CAS | 22204-53-1 |
| MW: | 230,26 D |
ab 79,00 €
(S)-(+)-Naproxene
Artikelnummer: CDX-N0061-G001
White powder. Soluble in water (>3 mg/ml at 25 °C), methanol, DMSO, DMF (100 mg/ml), chloroform, dichloromethane, ether, ethylacetate or tetrahydrofuran. Non-selective COX inhibitor. The IC50 values for human recombinant COX-1 and -2 are 0.6-4.8 µM and 2.0-28.4 µM, respectively. Naproxen is a potent, non-steroidal,...
| Schlagworte: | Naprosyn, Equiproxen, Laraflex, (S)-(+)-6-Methoxy-alpha-methyl-2-naphthalene acetic acid |
| Anwendung: | Non-selective COX inhibitor |
| CAS | 22204-53-1 |
| MW: | 230,26 D |
ab 37,00 €
Naproxen
Artikelnummer: TGM-T1582-1mL
Description: Naproxen ((S)-Naproxen) is a propionic acid derivative and a non-steroidal anti-inflammatory drug (NSAID) with anti-inflammatory, antipyretic and analgesic activities. Target: COX, Autophagy. Smiles: [C@H](C(O)=O)(C)C1=CC2=C(C=C(OC)C=C2)C=C1. References: Albertini R, et al. Inflamm Res. 2007...
| Schlagworte: | (S)-Naproxen |
| Anwendung: | Targets prostaglandin-endoperoxide synthase 1 [EC:1.14.99.1] (PTGS1, COX1) |
| CAS | 22204-53-1 |
| MW: | 230.26 D |
ab 39,00 €
