Zu "221243-01-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Homotyrosine, (+)-
Artikelnummer: TGM-T25506-100mg
Description: Homotyrosine, (+)- is an amino acid used as a very stable, selective, and renally safe sodium channel blocker. Target: Others. Smiles: N[C@@H](CCc1ccc(O)cc1)C(O)=O. References: Radha Rama Devi A, Naushad SM. SLC25A13 c.1610_1612delinsAT mutation in an Indian patient and literature review of 79 cases of...
| Schlagworte: | L-Homotyrosine, alpha-Homotyrosine, (+)- |
| CAS | 221243-01-2 |
| MW: | 195.22 D |
ab 1.440,00 €
H-L-HomoTyr-OH HBr
Artikelnummer: CSB-DT2550.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| CAS | 221243-01-2 |
| MW: | 276.13 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
